C10H11FO5 — CID 171877281
4-(4-fluoro-3-hydroxyphenyl)-3,4-dihydroxybutanoic acid (PubChem CID 171877281) has the molecular formula C10H11FO5 and a molecular weight of 230.19 g/mol. Its IUPAC name is 4-(4-fluoro-3-hydroxyphenyl)-3,4-dihydroxybutanoic acid.
| Compound Name | 4-(4-fluoro-3-hydroxyphenyl)-3,4-dihydroxybutanoic acid |
|---|---|
| PubChem CID | 171877281 |
| Molecular Formula | C10H11FO5 |
| Molecular Weight | 230.19 g/mol |
| Exact Mass | 230.06 |
| IUPAC Name | 4-(4-fluoro-3-hydroxyphenyl)-3,4-dihydroxybutanoic acid |
| SMILES | O=C(O)CC(O)C(O)c1ccc(F)c(O)c1 |
| InChI | InChI=1S/C10H11FO5/c11-6-2-1-5(3-7(6)12)10(16)8(13)4-9(14)15/h1-3,8,10,12-13,16H,4H2,(H,14,15) |
| InChIKey | NQGYVJOWUVOZKK-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.19 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |