C10H12BrNO4 — CID 171878770
4-(4-amino-3-bromophenyl)-3,4-dihydroxybutanoic acid (PubChem CID 171878770) has the molecular formula C10H12BrNO4 and a molecular weight of 290.11 g/mol. Its IUPAC name is 4-(4-amino-3-bromophenyl)-3,4-dihydroxybutanoic acid.
| Compound Name | 4-(4-amino-3-bromophenyl)-3,4-dihydroxybutanoic acid |
|---|---|
| PubChem CID | 171878770 |
| Molecular Formula | C10H12BrNO4 |
| Molecular Weight | 290.11 g/mol |
| Exact Mass | 288.99 |
| IUPAC Name | 4-(4-amino-3-bromophenyl)-3,4-dihydroxybutanoic acid |
| SMILES | Nc1ccc(C(O)C(O)CC(=O)O)cc1Br |
| InChI | InChI=1S/C10H12BrNO4/c11-6-3-5(1-2-7(6)12)10(16)8(13)4-9(14)15/h1-3,8,10,13,16H,4,12H2,(H,14,15) |
| InChIKey | GPJFDJYMRREUBH-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.11 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|