C8H11N3O4 — CID 171877191
4-(2-aminopyrimidin-5-yl)-3,4-dihydroxybutanoic acid (PubChem CID 171877191) has the molecular formula C8H11N3O4 and a molecular weight of 213.19 g/mol. Its IUPAC name is 4-(2-aminopyrimidin-5-yl)-3,4-dihydroxybutanoic acid.
| Compound Name | 4-(2-aminopyrimidin-5-yl)-3,4-dihydroxybutanoic acid |
|---|---|
| PubChem CID | 171877191 |
| Molecular Formula | C8H11N3O4 |
| Molecular Weight | 213.19 g/mol |
| Exact Mass | 213.07 |
| IUPAC Name | 4-(2-aminopyrimidin-5-yl)-3,4-dihydroxybutanoic acid |
| SMILES | Nc1ncc(C(O)C(O)CC(=O)O)cn1 |
| InChI | InChI=1S/C8H11N3O4/c9-8-10-2-4(3-11-8)7(15)5(12)1-6(13)14/h2-3,5,7,12,15H,1H2,(H,13,14)(H2,9,10,11) |
| InChIKey | IGAWJOHWVXNZGV-UHFFFAOYSA-N |
| XLogP | -1.07 |
| TPSA | 129.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.19 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |