C12H15NO5 — CID 171878164
4-[4-(2-aminoacetyl)phenyl]-3,4-dihydroxybutanoic acid (PubChem CID 171878164) has the molecular formula C12H15NO5 and a molecular weight of 253.25 g/mol. Its IUPAC name is 4-[4-(2-aminoacetyl)phenyl]-3,4-dihydroxybutanoic acid.
| Compound Name | 4-[4-(2-aminoacetyl)phenyl]-3,4-dihydroxybutanoic acid |
|---|---|
| PubChem CID | 171878164 |
| Molecular Formula | C12H15NO5 |
| Molecular Weight | 253.25 g/mol |
| Exact Mass | 253.10 |
| IUPAC Name | 4-[4-(2-aminoacetyl)phenyl]-3,4-dihydroxybutanoic acid |
| SMILES | NCC(=O)c1ccc(C(O)C(O)CC(=O)O)cc1 |
| InChI | InChI=1S/C12H15NO5/c13-6-10(15)7-1-3-8(4-2-7)12(18)9(14)5-11(16)17/h1-4,9,12,14,18H,5-6,13H2,(H,16,17) |
| InChIKey | SEEBVYCZYXMXIR-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 120.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.25 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |