C11H14N2O4S — CID 171878043
4-[4-(carbamothioylamino)phenyl]-3,4-dihydroxybutanoic acid (PubChem CID 171878043) has the molecular formula C11H14N2O4S and a molecular weight of 270.31 g/mol. Its IUPAC name is 4-[4-(carbamothioylamino)phenyl]-3,4-dihydroxybutanoic acid.
| Compound Name | 4-[4-(carbamothioylamino)phenyl]-3,4-dihydroxybutanoic acid |
|---|---|
| PubChem CID | 171878043 |
| Molecular Formula | C11H14N2O4S |
| Molecular Weight | 270.31 g/mol |
| Exact Mass | 270.07 |
| IUPAC Name | 4-[4-(carbamothioylamino)phenyl]-3,4-dihydroxybutanoic acid |
| SMILES | NC(=S)Nc1ccc(C(O)C(O)CC(=O)O)cc1 |
| InChI | InChI=1S/C11H14N2O4S/c12-11(18)13-7-3-1-6(2-4-7)10(17)8(14)5-9(15)16/h1-4,8,10,14,17H,5H2,(H,15,16)(H3,12,13,18) |
| InChIKey | RDKZUOYDVRZYPF-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.31 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|