C11H13NO5 — CID 171899034
4-(4-amino-1,2-dihydroxy-4-oxobutyl)benzoic acid (PubChem CID 171899034) has the molecular formula C11H13NO5 and a molecular weight of 239.23 g/mol. Its IUPAC name is 4-(4-amino-1,2-dihydroxy-4-oxobutyl)benzoic acid.
| Compound Name | 4-(4-amino-1,2-dihydroxy-4-oxobutyl)benzoic acid |
|---|---|
| PubChem CID | 171899034 |
| Molecular Formula | C11H13NO5 |
| Molecular Weight | 239.23 g/mol |
| Exact Mass | 239.08 |
| IUPAC Name | 4-(4-amino-1,2-dihydroxy-4-oxobutyl)benzoic acid |
| SMILES | NC(=O)CC(O)C(O)c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C11H13NO5/c12-9(14)5-8(13)10(15)6-1-3-7(4-2-6)11(16)17/h1-4,8,10,13,15H,5H2,(H2,12,14)(H,16,17) |
| InChIKey | HXQVFZVEHHFTHQ-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 120.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.23 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |