C11H14ClNO4 — CID 171877702
4-(4-amino-3-chloro-5-methylphenyl)-3,4-dihydroxybutanoic acid (PubChem CID 171877702) has the molecular formula C11H14ClNO4 and a molecular weight of 259.69 g/mol. Its IUPAC name is 4-(4-amino-3-chloro-5-methylphenyl)-3,4-dihydroxybutanoic acid.
| Compound Name | 4-(4-amino-3-chloro-5-methylphenyl)-3,4-dihydroxybutanoic acid |
|---|---|
| PubChem CID | 171877702 |
| Molecular Formula | C11H14ClNO4 |
| Molecular Weight | 259.69 g/mol |
| Exact Mass | 259.06 |
| IUPAC Name | 4-(4-amino-3-chloro-5-methylphenyl)-3,4-dihydroxybutanoic acid |
| SMILES | Cc1cc(C(O)C(O)CC(=O)O)cc(Cl)c1N |
| InChI | InChI=1S/C11H14ClNO4/c1-5-2-6(3-7(12)10(5)13)11(17)8(14)4-9(15)16/h2-3,8,11,14,17H,4,13H2,1H3,(H,15,16) |
| InChIKey | CIWNPMKCAVVEKW-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.69 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|