C12H13ClO6 — CID 171878228
4-(3-chloro-4-methoxycarbonylphenyl)-3,4-dihydroxybutanoic acid (PubChem CID 171878228) has the molecular formula C12H13ClO6 and a molecular weight of 288.68 g/mol. Its IUPAC name is 4-(3-chloro-4-methoxycarbonylphenyl)-3,4-dihydroxybutanoic acid.
| Compound Name | 4-(3-chloro-4-methoxycarbonylphenyl)-3,4-dihydroxybutanoic acid |
|---|---|
| PubChem CID | 171878228 |
| Molecular Formula | C12H13ClO6 |
| Molecular Weight | 288.68 g/mol |
| Exact Mass | 288.04 |
| IUPAC Name | 4-(3-chloro-4-methoxycarbonylphenyl)-3,4-dihydroxybutanoic acid |
| SMILES | COC(=O)c1ccc(C(O)C(O)CC(=O)O)cc1Cl |
| InChI | InChI=1S/C12H13ClO6/c1-19-12(18)7-3-2-6(4-8(7)13)11(17)9(14)5-10(15)16/h2-4,9,11,14,17H,5H2,1H3,(H,15,16) |
| InChIKey | OWXDYYLKVKXDIJ-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.68 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |