C12H14F2N2O2 — CID 171890638
4-[1,2-dihydroxy-4-(methylamino)butyl]-2,6-difluorobenzonitrile (PubChem CID 171890638) has the molecular formula C12H14F2N2O2 and a molecular weight of 256.25 g/mol. Its IUPAC name is 4-[1,2-dihydroxy-4-(methylamino)butyl]-2,6-difluorobenzonitrile.
| Compound Name | 4-[1,2-dihydroxy-4-(methylamino)butyl]-2,6-difluorobenzonitrile |
|---|---|
| PubChem CID | 171890638 |
| Molecular Formula | C12H14F2N2O2 |
| Molecular Weight | 256.25 g/mol |
| Exact Mass | 256.10 |
| IUPAC Name | 4-[1,2-dihydroxy-4-(methylamino)butyl]-2,6-difluorobenzonitrile |
| SMILES | CNCCC(O)C(O)c1cc(F)c(C#N)c(F)c1 |
| InChI | InChI=1S/C12H14F2N2O2/c1-16-3-2-11(17)12(18)7-4-9(13)8(6-15)10(14)5-7/h4-5,11-12,16-18H,2-3H2,1H3 |
| InChIKey | KUHMYIRCMMQPCV-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 76.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.25 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |