C13H4F7N3 — CID 22971706
4-amino-2,3,5-trifluoro-6-(2,3,5,6-tetrafluoroanilino)benzonitrile (PubChem CID 22971706) has the molecular formula C13H4F7N3 and a molecular weight of 335.18 g/mol. Its IUPAC name is 4-amino-2,3,5-trifluoro-6-(2,3,5,6-tetrafluoroanilino)benzonitrile.
| Compound Name | 4-amino-2,3,5-trifluoro-6-(2,3,5,6-tetrafluoroanilino)benzonitrile |
|---|---|
| PubChem CID | 22971706 |
| Molecular Formula | C13H4F7N3 |
| Molecular Weight | 335.18 g/mol |
| Exact Mass | 335.03 |
| IUPAC Name | 4-amino-2,3,5-trifluoro-6-(2,3,5,6-tetrafluoroanilino)benzonitrile |
| SMILES | N#Cc1c(F)c(F)c(N)c(F)c1Nc1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C13H4F7N3/c14-4-1-5(15)8(18)13(7(4)17)23-12-3(2-21)6(16)9(19)11(22)10(12)20/h1,23H,22H2 |
| InChIKey | VZLGCQBDCCLTTH-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 61.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.18 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|