C13H8F4N4 — CID 107644815
5,6-dimethyl-3-(2,3,5,6-tetrafluoroanilino)pyridazine-4-carbonitrile (PubChem CID 107644815) has the molecular formula C13H8F4N4 and a molecular weight of 296.23 g/mol. Its IUPAC name is 5,6-dimethyl-3-(2,3,5,6-tetrafluoroanilino)pyridazine-4-carbonitrile.
| Compound Name | 5,6-dimethyl-3-(2,3,5,6-tetrafluoroanilino)pyridazine-4-carbonitrile |
|---|---|
| PubChem CID | 107644815 |
| Molecular Formula | C13H8F4N4 |
| Molecular Weight | 296.23 g/mol |
| Exact Mass | 296.07 |
| IUPAC Name | 5,6-dimethyl-3-(2,3,5,6-tetrafluoroanilino)pyridazine-4-carbonitrile |
| SMILES | Cc1nnc(Nc2c(F)c(F)cc(F)c2F)c(C#N)c1C |
| InChI | InChI=1S/C13H8F4N4/c1-5-6(2)20-21-13(7(5)4-18)19-12-10(16)8(14)3-9(15)11(12)17/h3H,1-2H3,(H,19,21) |
| InChIKey | KAOBXUUUPQEZOT-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.23 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|