C13H10Cl2N4 — CID 61096638
3-(3,5-dichloroanilino)-5,6-dimethylpyridazine-4-carbonitrile (PubChem CID 61096638) has the molecular formula C13H10Cl2N4 and a molecular weight of 293.16 g/mol. Its IUPAC name is 3-(3,5-dichloroanilino)-5,6-dimethylpyridazine-4-carbonitrile.
| Compound Name | 3-(3,5-dichloroanilino)-5,6-dimethylpyridazine-4-carbonitrile |
|---|---|
| PubChem CID | 61096638 |
| Molecular Formula | C13H10Cl2N4 |
| Molecular Weight | 293.16 g/mol |
| Exact Mass | 292.03 |
| IUPAC Name | 3-(3,5-dichloroanilino)-5,6-dimethylpyridazine-4-carbonitrile |
| SMILES | Cc1nnc(Nc2cc(Cl)cc(Cl)c2)c(C#N)c1C |
| InChI | InChI=1S/C13H10Cl2N4/c1-7-8(2)18-19-13(12(7)6-16)17-11-4-9(14)3-10(15)5-11/h3-5H,1-2H3,(H,17,19) |
| InChIKey | FBJIJTAVXVUTIT-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.16 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |