About ethane;2,3,5,6-tetrafluoroaniline
ethane;2,3,5,6-tetrafluoroaniline (PubChem CID 154678720) has the molecular formula C8H9F4N
and a molecular weight of 195.16 g/mol. Its IUPAC name is ethane;2,3,5,6-tetrafluoroaniline.
Molecular Properties
| Compound Name | ethane;2,3,5,6-tetrafluoroaniline |
| PubChem CID | 154678720 |
| Molecular Formula | C8H9F4N |
| Molecular Weight | 195.16 g/mol |
| Exact Mass | 195.07 |
| IUPAC Name | ethane;2,3,5,6-tetrafluoroaniline |
| SMILES | CC.Nc1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C6H3F4N.C2H6/c7-2-1-3(8)5(10)6(11)4(2)9;1-2/h1H,11H2;1-2H3 |
| InChIKey | RKQRVVDQXRFYOM-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.16 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze ethane;2,3,5,6-tetrafluoroaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2,3,5,6-tetrafluoroaniline?
The IUPAC name of ethane;2,3,5,6-tetrafluoroaniline (CID 154678720) is ethane;2,3,5,6-tetrafluoroaniline.
What is the SMILES notation for ethane;2,3,5,6-tetrafluoroaniline?
The canonical SMILES for ethane;2,3,5,6-tetrafluoroaniline is CC.Nc1c(F)c(F)cc(F)c1F.
What is the InChIKey of ethane;2,3,5,6-tetrafluoroaniline?
The InChIKey is RKQRVVDQXRFYOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H3F4N.C2H6/c7-2-1-3(8)5(10)6(11)4(2)9;1-2/h1H,11H2;1-2H3.
What are the key properties of ethane;2,3,5,6-tetrafluoroaniline?
ethane;2,3,5,6-tetrafluoroaniline has a molecular weight of 195.16 g/mol, XLogP of 2.85, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2,3,5,6-tetrafluoroaniline is sourced from PubChem (CID 154678720), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).