C12H4F7N3 — CID 23235310
3,4,6-trifluoro-2-[(2,3,5,6-tetrafluorophenyl)diazenyl]aniline (PubChem CID 23235310) has the molecular formula C12H4F7N3 and a molecular weight of 323.17 g/mol. Its IUPAC name is 3,4,6-trifluoro-2-[(2,3,5,6-tetrafluorophenyl)diazenyl]aniline.
| Compound Name | 3,4,6-trifluoro-2-[(2,3,5,6-tetrafluorophenyl)diazenyl]aniline |
|---|---|
| PubChem CID | 23235310 |
| Molecular Formula | C12H4F7N3 |
| Molecular Weight | 323.17 g/mol |
| Exact Mass | 323.03 |
| IUPAC Name | 3,4,6-trifluoro-2-[(2,3,5,6-tetrafluorophenyl)diazenyl]aniline |
| SMILES | Nc1c(F)cc(F)c(F)c1/N=N/c1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C12H4F7N3/c13-3-1-4(14)8(18)11(7(3)17)21-22-12-9(19)5(15)2-6(16)10(12)20/h1-2H,20H2/b22-21+ |
| InChIKey | INIHHJMPQAJZPQ-QURGRASLSA-N |
| XLogP | 4.66 |
| TPSA | 50.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.17 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|