C12H16F4 — CID 155699837
2-tert-butyl-1,3,4,5-tetrafluorobenzene;ethane (PubChem CID 155699837) has the molecular formula C12H16F4 and a molecular weight of 236.25 g/mol. Its IUPAC name is 2-tert-butyl-1,3,4,5-tetrafluorobenzene;ethane.
| Compound Name | 2-tert-butyl-1,3,4,5-tetrafluorobenzene;ethane |
|---|---|
| PubChem CID | 155699837 |
| Molecular Formula | C12H16F4 |
| Molecular Weight | 236.25 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | 2-tert-butyl-1,3,4,5-tetrafluorobenzene;ethane |
| SMILES | CC.CC(C)(C)c1c(F)cc(F)c(F)c1F |
| InChI | InChI=1S/C10H10F4.C2H6/c1-10(2,3)7-5(11)4-6(12)8(13)9(7)14;1-2/h4H,1-3H3;1-2H3 |
| InChIKey | JHZKRHZGCHCIMC-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.25 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|