C9H10F6 — CID 165395755
ethane;fluoromethane;1,2,3,4,5-pentafluorobenzene (PubChem CID 165395755) has the molecular formula C9H10F6 and a molecular weight of 232.17 g/mol. Its IUPAC name is ethane;fluoromethane;1,2,3,4,5-pentafluorobenzene.
| Compound Name | ethane;fluoromethane;1,2,3,4,5-pentafluorobenzene |
|---|---|
| PubChem CID | 165395755 |
| Molecular Formula | C9H10F6 |
| Molecular Weight | 232.17 g/mol |
| Exact Mass | 232.07 |
| IUPAC Name | ethane;fluoromethane;1,2,3,4,5-pentafluorobenzene |
| SMILES | CC.CF.Fc1cc(F)c(F)c(F)c1F |
| InChI | InChI=1S/C6HF5.C2H6.CH3F/c7-2-1-3(8)5(10)6(11)4(2)9;2*1-2/h1H;1-2H3;1H3 |
| InChIKey | FLKHQWKUZBPEGZ-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.17 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|