C6HBr2F5Mg — CID 157145782
magnesium;1,2,3,4,5-pentafluorobenzene;dibromide (PubChem CID 157145782) has the molecular formula C6HBr2F5Mg and a molecular weight of 352.18 g/mol. Its IUPAC name is magnesium;1,2,3,4,5-pentafluorobenzene;dibromide.
| Compound Name | magnesium;1,2,3,4,5-pentafluorobenzene;dibromide |
|---|---|
| PubChem CID | 157145782 |
| Molecular Formula | C6HBr2F5Mg |
| Molecular Weight | 352.18 g/mol |
| Exact Mass | 349.82 |
| IUPAC Name | magnesium;1,2,3,4,5-pentafluorobenzene;dibromide |
| SMILES | Fc1cc(F)c(F)c(F)c1F.[Br-].[Br-].[Mg+2] |
| InChI | InChI=1S/C6HF5.2BrH.Mg/c7-2-1-3(8)5(10)6(11)4(2)9;;;/h1H;2*1H;/q;;;+2/p-2 |
| InChIKey | AKRNJVBIJKZYBA-UHFFFAOYSA-L |
| XLogP | -3.99 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.18 |
| LogP ≤ 5 | -3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|