C22H2F14 — CID 12635103
1,2,3,5,6,7-hexafluoro-4,8-bis(2,3,4,6-tetrafluorophenyl)naphthalene (PubChem CID 12635103) has the molecular formula C22H2F14 and a molecular weight of 532.23 g/mol. Its IUPAC name is 1,2,3,5,6,7-hexafluoro-4,8-bis(2,3,4,6-tetrafluorophenyl)naphthalene.
| Compound Name | 1,2,3,5,6,7-hexafluoro-4,8-bis(2,3,4,6-tetrafluorophenyl)naphthalene |
|---|---|
| PubChem CID | 12635103 |
| Molecular Formula | C22H2F14 |
| Molecular Weight | 532.23 g/mol |
| Exact Mass | 531.99 |
| IUPAC Name | 1,2,3,5,6,7-hexafluoro-4,8-bis(2,3,4,6-tetrafluorophenyl)naphthalene |
| SMILES | Fc1cc(F)c(-c2c(F)c(F)c(F)c3c(-c4c(F)cc(F)c(F)c4F)c(F)c(F)c(F)c23)c(F)c1F |
| InChI | InChI=1S/C22H2F14/c23-3-1-5(25)13(27)15(29)7(3)9-11-12(20(34)21(35)17(9)31)10(18(32)22(36)19(11)33)8-4(24)2-6(26)14(28)16(8)30/h1-2H |
| InChIKey | HPZUZJNZBLJOCH-UHFFFAOYSA-N |
| XLogP | 8.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.23 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|