C36H3BF24 — CID 22500998
tris[2,3,4,6-tetrafluoro-5-(2,3,4,6-tetrafluorophenyl)phenyl]borane (PubChem CID 22500998) has the molecular formula C36H3BF24 and a molecular weight of 902.18 g/mol. Its IUPAC name is tris[2,3,4,6-tetrafluoro-5-(2,3,4,6-tetrafluorophenyl)phenyl]borane.
| Compound Name | tris[2,3,4,6-tetrafluoro-5-(2,3,4,6-tetrafluorophenyl)phenyl]borane |
|---|---|
| PubChem CID | 22500998 |
| Molecular Formula | C36H3BF24 |
| Molecular Weight | 902.18 g/mol |
| Exact Mass | 901.99 |
| IUPAC Name | tris[2,3,4,6-tetrafluoro-5-(2,3,4,6-tetrafluorophenyl)phenyl]borane |
| SMILES | Fc1cc(F)c(-c2c(F)c(F)c(F)c(B(c3c(F)c(F)c(F)c(-c4c(F)cc(F)c(F)c4F)c3F)c3c(F)c(F)c(F)c(-c4c(F)cc(F)c(F)c4F)c3F)c2F)c(F)c1F |
| InChI | InChI=1S/C36H3BF24/c38-4-1-7(41)19(44)25(50)10(4)13-22(47)16(31(56)34(59)28(13)53)37(17-23(48)14(29(54)35(60)32(17)57)11-5(39)2-8(42)20(45)26(11)51)18-24(49)15(30(55)36(61)33(18)58)12-6(40)3-9(43)21(46)27(12)52/h1-3H |
| InChIKey | DHWDUGONFSKLKN-UHFFFAOYSA-N |
| XLogP | 10.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 902.18 |
| LogP ≤ 5 | 10.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|