C20H10BF9 — CID 145237397
(3,5-dimethylphenyl)-(2,3,4,5,6-pentafluorophenyl)-(2,3,4,6-tetrafluorophenyl)borane (PubChem CID 145237397) has the molecular formula C20H10BF9 and a molecular weight of 432.09 g/mol. Its IUPAC name is (3,5-dimethylphenyl)-(2,3,4,5,6-pentafluorophenyl)-(2,3,4,6-tetrafluorophenyl)borane.
| Compound Name | (3,5-dimethylphenyl)-(2,3,4,5,6-pentafluorophenyl)-(2,3,4,6-tetrafluorophenyl)borane |
|---|---|
| PubChem CID | 145237397 |
| Molecular Formula | C20H10BF9 |
| Molecular Weight | 432.09 g/mol |
| Exact Mass | 432.07 |
| IUPAC Name | (3,5-dimethylphenyl)-(2,3,4,5,6-pentafluorophenyl)-(2,3,4,6-tetrafluorophenyl)borane |
| SMILES | Cc1cc(C)cc(B(c2c(F)cc(F)c(F)c2F)c2c(F)c(F)c(F)c(F)c2F)c1 |
| InChI | InChI=1S/C20H10BF9/c1-7-3-8(2)5-9(4-7)21(12-10(22)6-11(23)14(24)15(12)25)13-16(26)18(28)20(30)19(29)17(13)27/h3-6H,1-2H3 |
| InChIKey | JPJVBVIBWMDAAT-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.09 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|