C21H12BF9 — CID 177045825
bis(2,3,6-trifluoro-4-methylphenyl)-(2,4,6-trifluoro-3-methylphenyl)borane (PubChem CID 177045825) has the molecular formula C21H12BF9 and a molecular weight of 446.12 g/mol. Its IUPAC name is bis(2,3,6-trifluoro-4-methylphenyl)-(2,4,6-trifluoro-3-methylphenyl)borane.
| Compound Name | bis(2,3,6-trifluoro-4-methylphenyl)-(2,4,6-trifluoro-3-methylphenyl)borane |
|---|---|
| PubChem CID | 177045825 |
| Molecular Formula | C21H12BF9 |
| Molecular Weight | 446.12 g/mol |
| Exact Mass | 446.09 |
| IUPAC Name | bis(2,3,6-trifluoro-4-methylphenyl)-(2,4,6-trifluoro-3-methylphenyl)borane |
| SMILES | Cc1cc(F)c(B(c2c(F)cc(F)c(C)c2F)c2c(F)cc(C)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C21H12BF9/c1-7-4-11(24)15(20(30)17(7)27)22(14-13(26)6-10(23)9(3)19(14)29)16-12(25)5-8(2)18(28)21(16)31/h4-6H,1-3H3 |
| InChIKey | QYLMMXZURFFVES-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.12 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|