C7H6BF3O2 — CID 24901772
(2,4,6-trifluoro-3-methylphenyl)boronic acid (PubChem CID 24901772) has the molecular formula C7H6BF3O2 and a molecular weight of 189.93 g/mol. Its IUPAC name is (2,4,6-trifluoro-3-methylphenyl)boronic acid.
| Compound Name | (2,4,6-trifluoro-3-methylphenyl)boronic acid |
|---|---|
| PubChem CID | 24901772 |
| Molecular Formula | C7H6BF3O2 |
| Molecular Weight | 189.93 g/mol |
| Exact Mass | 190.04 |
| IUPAC Name | (2,4,6-trifluoro-3-methylphenyl)boronic acid |
| SMILES | Cc1c(F)cc(F)c(B(O)O)c1F |
| InChI | InChI=1S/C7H6BF3O2/c1-3-4(9)2-5(10)6(7(3)11)8(12)13/h2,12-13H,1H3 |
| InChIKey | ATGZNBFLYKFGLK-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.93 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|