(2-fluoro-3,4,5,6-tetramethylphenyl)boronic acid

C10H14BFO2 — CID 18684948

IUPAC(2-fluoro-3,4,5,6-tetramethylphenyl)boronic acid
SMILESCc1c(C)c(C)c(B(O)O)c(F)c1C
InChIInChI=1S/C10H14BFO2/c1-5-6(2)8(4)10(12)9(7(5)3)11(13)14/h13-14H,1-4H3
InChIKeyWZSWRTXQFRSTMV-UHFFFAOYSA-N
MW196.03 g/mol
LogP0.74
Rot. Bonds1

About (2-fluoro-3,4,5,6-tetramethylphenyl)boronic acid

(2-fluoro-3,4,5,6-tetramethylphenyl)boronic acid (PubChem CID 18684948) has the molecular formula C10H14BFO2 and a molecular weight of 196.03 g/mol. Its IUPAC name is (2-fluoro-3,4,5,6-tetramethylphenyl)boronic acid.

Molecular Properties

Compound Name(2-fluoro-3,4,5,6-tetramethylphenyl)boronic acid
PubChem CID18684948
Molecular FormulaC10H14BFO2
Molecular Weight196.03 g/mol
Exact Mass196.11
IUPAC Name(2-fluoro-3,4,5,6-tetramethylphenyl)boronic acid
SMILESCc1c(C)c(C)c(B(O)O)c(F)c1C
InChIInChI=1S/C10H14BFO2/c1-5-6(2)8(4)10(12)9(7(5)3)11(13)14/h13-14H,1-4H3
InChIKeyWZSWRTXQFRSTMV-UHFFFAOYSA-N
XLogP0.74
TPSA40.46 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500196.03
LogP ≤ 50.74
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze (2-fluoro-3,4,5,6-tetramethylphenyl)boronic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2-fluoro-3,4,5,6-tetramethylphenyl)boronic acid?
The IUPAC name of (2-fluoro-3,4,5,6-tetramethylphenyl)boronic acid (CID 18684948) is (2-fluoro-3,4,5,6-tetramethylphenyl)boronic acid.
What is the SMILES notation for (2-fluoro-3,4,5,6-tetramethylphenyl)boronic acid?
The canonical SMILES for (2-fluoro-3,4,5,6-tetramethylphenyl)boronic acid is Cc1c(C)c(C)c(B(O)O)c(F)c1C.
What is the InChIKey of (2-fluoro-3,4,5,6-tetramethylphenyl)boronic acid?
The InChIKey is WZSWRTXQFRSTMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14BFO2/c1-5-6(2)8(4)10(12)9(7(5)3)11(13)14/h13-14H,1-4H3.
What are the key properties of (2-fluoro-3,4,5,6-tetramethylphenyl)boronic acid?
(2-fluoro-3,4,5,6-tetramethylphenyl)boronic acid has a molecular weight of 196.03 g/mol, XLogP of 0.74, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2-fluoro-3,4,5,6-tetramethylphenyl)boronic acid is sourced from PubChem (CID 18684948), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).