C10H14BFO2 — CID 18684948
(2-fluoro-3,4,5,6-tetramethylphenyl)boronic acid (PubChem CID 18684948) has the molecular formula C10H14BFO2 and a molecular weight of 196.03 g/mol. Its IUPAC name is (2-fluoro-3,4,5,6-tetramethylphenyl)boronic acid.
| Compound Name | (2-fluoro-3,4,5,6-tetramethylphenyl)boronic acid |
|---|---|
| PubChem CID | 18684948 |
| Molecular Formula | C10H14BFO2 |
| Molecular Weight | 196.03 g/mol |
| Exact Mass | 196.11 |
| IUPAC Name | (2-fluoro-3,4,5,6-tetramethylphenyl)boronic acid |
| SMILES | Cc1c(C)c(C)c(B(O)O)c(F)c1C |
| InChI | InChI=1S/C10H14BFO2/c1-5-6(2)8(4)10(12)9(7(5)3)11(13)14/h13-14H,1-4H3 |
| InChIKey | WZSWRTXQFRSTMV-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.03 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|