About (2-chloro-3,4,5,6-tetramethylphenyl)boronic acid
(2-chloro-3,4,5,6-tetramethylphenyl)boronic acid (PubChem CID 174081656) has the molecular formula C10H14BClO2
and a molecular weight of 212.48 g/mol. Its IUPAC name is (2-chloro-3,4,5,6-tetramethylphenyl)boronic acid.
Molecular Properties
| Compound Name | (2-chloro-3,4,5,6-tetramethylphenyl)boronic acid |
| PubChem CID | 174081656 |
| Molecular Formula | C10H14BClO2 |
| Molecular Weight | 212.48 g/mol |
| Exact Mass | 212.08 |
| IUPAC Name | (2-chloro-3,4,5,6-tetramethylphenyl)boronic acid |
| SMILES | Cc1c(C)c(C)c(B(O)O)c(Cl)c1C |
| InChI | InChI=1S/C10H14BClO2/c1-5-6(2)8(4)10(12)9(7(5)3)11(13)14/h13-14H,1-4H3 |
| InChIKey | HYARQPGFPBBBBS-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.48 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (2-chloro-3,4,5,6-tetramethylphenyl)boronic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-chloro-3,4,5,6-tetramethylphenyl)boronic acid?
The IUPAC name of (2-chloro-3,4,5,6-tetramethylphenyl)boronic acid (CID 174081656) is (2-chloro-3,4,5,6-tetramethylphenyl)boronic acid.
What is the SMILES notation for (2-chloro-3,4,5,6-tetramethylphenyl)boronic acid?
The canonical SMILES for (2-chloro-3,4,5,6-tetramethylphenyl)boronic acid is Cc1c(C)c(C)c(B(O)O)c(Cl)c1C.
What is the InChIKey of (2-chloro-3,4,5,6-tetramethylphenyl)boronic acid?
The InChIKey is HYARQPGFPBBBBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14BClO2/c1-5-6(2)8(4)10(12)9(7(5)3)11(13)14/h13-14H,1-4H3.
What are the key properties of (2-chloro-3,4,5,6-tetramethylphenyl)boronic acid?
(2-chloro-3,4,5,6-tetramethylphenyl)boronic acid has a molecular weight of 212.48 g/mol, XLogP of 1.25, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2-chloro-3,4,5,6-tetramethylphenyl)boronic acid is sourced from PubChem (CID 174081656), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).