C21H27Cl — CID 54008423
1-chloro-2,3,5,6-tetramethyl-4-(2,3,4,5,6-pentamethylphenyl)benzene (PubChem CID 54008423) has the molecular formula C21H27Cl and a molecular weight of 314.90 g/mol. Its IUPAC name is 1-chloro-2,3,5,6-tetramethyl-4-(2,3,4,5,6-pentamethylphenyl)benzene.
| Compound Name | 1-chloro-2,3,5,6-tetramethyl-4-(2,3,4,5,6-pentamethylphenyl)benzene |
|---|---|
| PubChem CID | 54008423 |
| Molecular Formula | C21H27Cl |
| Molecular Weight | 314.90 g/mol |
| Exact Mass | 314.18 |
| IUPAC Name | 1-chloro-2,3,5,6-tetramethyl-4-(2,3,4,5,6-pentamethylphenyl)benzene |
| SMILES | Cc1c(C)c(C)c(-c2c(C)c(C)c(Cl)c(C)c2C)c(C)c1C |
| InChI | InChI=1S/C21H27Cl/c1-10-11(2)13(4)19(14(5)12(10)3)20-15(6)17(8)21(22)18(9)16(20)7/h1-9H3 |
| InChIKey | KQOCCSQFDKENAA-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.90 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |