C8H8Cl6 — CID 172812732
1,2,3,4-tetrachloro-5,6-dimethylbenzene;dihydrochloride (PubChem CID 172812732) has the molecular formula C8H8Cl6 and a molecular weight of 316.87 g/mol. Its IUPAC name is 1,2,3,4-tetrachloro-5,6-dimethylbenzene;dihydrochloride.
| Compound Name | 1,2,3,4-tetrachloro-5,6-dimethylbenzene;dihydrochloride |
|---|---|
| PubChem CID | 172812732 |
| Molecular Formula | C8H8Cl6 |
| Molecular Weight | 316.87 g/mol |
| Exact Mass | 313.88 |
| IUPAC Name | 1,2,3,4-tetrachloro-5,6-dimethylbenzene;dihydrochloride |
| SMILES | Cc1c(C)c(Cl)c(Cl)c(Cl)c1Cl.Cl.Cl |
| InChI | InChI=1S/C8H6Cl4.2ClH/c1-3-4(2)6(10)8(12)7(11)5(3)9;;/h1-2H3;2*1H |
| InChIKey | SKCFUVPCNVQCDU-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.87 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|