C9H9BrCl2 — CID 13202029
1-bromo-3,4-dichloro-2,5,6-trimethylbenzene (PubChem CID 13202029) has the molecular formula C9H9BrCl2 and a molecular weight of 267.98 g/mol. Its IUPAC name is 1-bromo-3,4-dichloro-2,5,6-trimethylbenzene.
| Compound Name | 1-bromo-3,4-dichloro-2,5,6-trimethylbenzene |
|---|---|
| PubChem CID | 13202029 |
| Molecular Formula | C9H9BrCl2 |
| Molecular Weight | 267.98 g/mol |
| Exact Mass | 265.93 |
| IUPAC Name | 1-bromo-3,4-dichloro-2,5,6-trimethylbenzene |
| SMILES | Cc1c(C)c(Br)c(C)c(Cl)c1Cl |
| InChI | InChI=1S/C9H9BrCl2/c1-4-5(2)8(11)9(12)6(3)7(4)10/h1-3H3 |
| InChIKey | CGQDENREQIHHJX-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.98 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|