C7H5Br2Cl — CID 44891208
1,4-dibromo-2-chloro-3-methylbenzene (PubChem CID 44891208) has the molecular formula C7H5Br2Cl and a molecular weight of 284.38 g/mol. Its IUPAC name is 1,4-dibromo-2-chloro-3-methylbenzene.
| Compound Name | 1,4-dibromo-2-chloro-3-methylbenzene |
|---|---|
| PubChem CID | 44891208 |
| Molecular Formula | C7H5Br2Cl |
| Molecular Weight | 284.38 g/mol |
| Exact Mass | 281.84 |
| IUPAC Name | 1,4-dibromo-2-chloro-3-methylbenzene |
| SMILES | Cc1c(Br)ccc(Br)c1Cl |
| InChI | InChI=1S/C7H5Br2Cl/c1-4-5(8)2-3-6(9)7(4)10/h2-3H,1H3 |
| InChIKey | FTQQPQNDEZNBJI-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.38 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|