C11H12BrClO2 — CID 137498901
2-(4-bromo-2-chloro-3-methylphenyl)-1,3-dioxane (PubChem CID 137498901) has the molecular formula C11H12BrClO2 and a molecular weight of 291.57 g/mol. Its IUPAC name is 2-(4-bromo-2-chloro-3-methylphenyl)-1,3-dioxane.
| Compound Name | 2-(4-bromo-2-chloro-3-methylphenyl)-1,3-dioxane |
|---|---|
| PubChem CID | 137498901 |
| Molecular Formula | C11H12BrClO2 |
| Molecular Weight | 291.57 g/mol |
| Exact Mass | 289.97 |
| IUPAC Name | 2-(4-bromo-2-chloro-3-methylphenyl)-1,3-dioxane |
| SMILES | Cc1c(Br)ccc(C2OCCCO2)c1Cl |
| InChI | InChI=1S/C11H12BrClO2/c1-7-9(12)4-3-8(10(7)13)11-14-5-2-6-15-11/h3-4,11H,2,5-6H2,1H3 |
| InChIKey | XAOOBFBGZVHTMT-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.57 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |