C12H14O3 — CID 91416344
3-(1,3-dioxan-2-yl)-2-methylbenzaldehyde (PubChem CID 91416344) has the molecular formula C12H14O3 and a molecular weight of 206.24 g/mol. Its IUPAC name is 3-(1,3-dioxan-2-yl)-2-methylbenzaldehyde.
| Compound Name | 3-(1,3-dioxan-2-yl)-2-methylbenzaldehyde |
|---|---|
| PubChem CID | 91416344 |
| Molecular Formula | C12H14O3 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | 3-(1,3-dioxan-2-yl)-2-methylbenzaldehyde |
| SMILES | Cc1c(C=O)cccc1C1OCCCO1 |
| InChI | InChI=1S/C12H14O3/c1-9-10(8-13)4-2-5-11(9)12-14-6-3-7-15-12/h2,4-5,8,12H,3,6-7H2,1H3 |
| InChIKey | AJGNCJPWKADONK-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|