C9H14N2O — CID 158628869
2,3-dimethylbenzaldehyde;hydrazine (PubChem CID 158628869) has the molecular formula C9H14N2O and a molecular weight of 166.22 g/mol. Its IUPAC name is 2,3-dimethylbenzaldehyde;hydrazine.
| Compound Name | 2,3-dimethylbenzaldehyde;hydrazine |
|---|---|
| PubChem CID | 158628869 |
| Molecular Formula | C9H14N2O |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.11 |
| IUPAC Name | 2,3-dimethylbenzaldehyde;hydrazine |
| SMILES | Cc1cccc(C=O)c1C.NN |
| InChI | InChI=1S/C9H10O.H4N2/c1-7-4-3-5-9(6-10)8(7)2;1-2/h3-6H,1-2H3;1-2H2 |
| InChIKey | HYYAQOFLMUHHJQ-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|