About 2-(2,3-dimethylanilino)benzaldehyde
2-(2,3-dimethylanilino)benzaldehyde (PubChem CID 15027376) has the molecular formula C15H15NO
and a molecular weight of 225.29 g/mol. Its IUPAC name is 2-(2,3-dimethylanilino)benzaldehyde.
Molecular Properties
| Compound Name | 2-(2,3-dimethylanilino)benzaldehyde |
| PubChem CID | 15027376 |
| Molecular Formula | C15H15NO |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.12 |
| IUPAC Name | 2-(2,3-dimethylanilino)benzaldehyde |
| SMILES | Cc1cccc(Nc2ccccc2C=O)c1C |
| InChI | InChI=1S/C15H15NO/c1-11-6-5-9-14(12(11)2)16-15-8-4-3-7-13(15)10-17/h3-10,16H,1-2H3 |
| InChIKey | PYSQMZPCKXSIPB-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,3-dimethylanilino)benzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,3-dimethylanilino)benzaldehyde?
The IUPAC name of 2-(2,3-dimethylanilino)benzaldehyde (CID 15027376) is 2-(2,3-dimethylanilino)benzaldehyde.
What is the SMILES notation for 2-(2,3-dimethylanilino)benzaldehyde?
The canonical SMILES for 2-(2,3-dimethylanilino)benzaldehyde is Cc1cccc(Nc2ccccc2C=O)c1C.
What is the InChIKey of 2-(2,3-dimethylanilino)benzaldehyde?
The InChIKey is PYSQMZPCKXSIPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15NO/c1-11-6-5-9-14(12(11)2)16-15-8-4-3-7-13(15)10-17/h3-10,16H,1-2H3.
What are the key properties of 2-(2,3-dimethylanilino)benzaldehyde?
2-(2,3-dimethylanilino)benzaldehyde has a molecular weight of 225.29 g/mol, XLogP of 3.86, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,3-dimethylanilino)benzaldehyde is sourced from PubChem (CID 15027376), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).