C10H10BrFO2 — CID 164894958
2-(4-bromo-2-fluoro-3-methylphenyl)-1,3-dioxolane (PubChem CID 164894958) has the molecular formula C10H10BrFO2 and a molecular weight of 261.09 g/mol. Its IUPAC name is 2-(4-bromo-2-fluoro-3-methylphenyl)-1,3-dioxolane.
| Compound Name | 2-(4-bromo-2-fluoro-3-methylphenyl)-1,3-dioxolane |
|---|---|
| PubChem CID | 164894958 |
| Molecular Formula | C10H10BrFO2 |
| Molecular Weight | 261.09 g/mol |
| Exact Mass | 259.98 |
| IUPAC Name | 2-(4-bromo-2-fluoro-3-methylphenyl)-1,3-dioxolane |
| SMILES | Cc1c(Br)ccc(C2OCCO2)c1F |
| InChI | InChI=1S/C10H10BrFO2/c1-6-8(11)3-2-7(9(6)12)10-13-4-5-14-10/h2-3,10H,4-5H2,1H3 |
| InChIKey | KMSNLGWKWDTCEG-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.09 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |