C12H15BrF2O2Si — CID 162504963
[3-bromo-4-(1,3-dioxolan-2-yl)-2,6-difluorophenyl]-trimethylsilane (PubChem CID 162504963) has the molecular formula C12H15BrF2O2Si and a molecular weight of 337.24 g/mol. Its IUPAC name is [3-bromo-4-(1,3-dioxolan-2-yl)-2,6-difluorophenyl]-trimethylsilane.
| Compound Name | [3-bromo-4-(1,3-dioxolan-2-yl)-2,6-difluorophenyl]-trimethylsilane |
|---|---|
| PubChem CID | 162504963 |
| Molecular Formula | C12H15BrF2O2Si |
| Molecular Weight | 337.24 g/mol |
| Exact Mass | 336.00 |
| IUPAC Name | [3-bromo-4-(1,3-dioxolan-2-yl)-2,6-difluorophenyl]-trimethylsilane |
| SMILES | C[Si](C)(C)c1c(F)cc(C2OCCO2)c(Br)c1F |
| InChI | InChI=1S/C12H15BrF2O2Si/c1-18(2,3)11-8(14)6-7(9(13)10(11)15)12-16-4-5-17-12/h6,12H,4-5H2,1-3H3 |
| InChIKey | QQQQZQKLQFJTEJ-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.24 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|