C10H7F2NO3 — CID 172693230
5-(1,3-dioxolan-2-yl)-6,7-difluoro-1,2-benzoxazole (PubChem CID 172693230) has the molecular formula C10H7F2NO3 and a molecular weight of 227.17 g/mol. Its IUPAC name is 5-(1,3-dioxolan-2-yl)-6,7-difluoro-1,2-benzoxazole.
| Compound Name | 5-(1,3-dioxolan-2-yl)-6,7-difluoro-1,2-benzoxazole |
|---|---|
| PubChem CID | 172693230 |
| Molecular Formula | C10H7F2NO3 |
| Molecular Weight | 227.17 g/mol |
| Exact Mass | 227.04 |
| IUPAC Name | 5-(1,3-dioxolan-2-yl)-6,7-difluoro-1,2-benzoxazole |
| SMILES | Fc1c(C2OCCO2)cc2cnoc2c1F |
| InChI | InChI=1S/C10H7F2NO3/c11-7-6(10-14-1-2-15-10)3-5-4-13-16-9(5)8(7)12/h3-4,10H,1-2H2 |
| InChIKey | BYSWWYMEWFCNBR-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 44.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.17 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |