About 5-(1,3-dioxolan-2-yl)-6,7-difluoro-1,2-benzoxazole
5-(1,3-dioxolan-2-yl)-6,7-difluoro-1,2-benzoxazole (PubChem CID 172693230) has the molecular formula C10H7F2NO3
and a molecular weight of 227.17 g/mol. Its IUPAC name is 5-(1,3-dioxolan-2-yl)-6,7-difluoro-1,2-benzoxazole.
Molecular Properties
| Compound Name | 5-(1,3-dioxolan-2-yl)-6,7-difluoro-1,2-benzoxazole |
| PubChem CID | 172693230 |
| Molecular Formula | C10H7F2NO3 |
| Molecular Weight | 227.17 g/mol |
| Exact Mass | 227.04 |
| IUPAC Name | 5-(1,3-dioxolan-2-yl)-6,7-difluoro-1,2-benzoxazole |
| SMILES | Fc1c(C2OCCO2)cc2cnoc2c1F |
| InChI | InChI=1S/C10H7F2NO3/c11-7-6(10-14-1-2-15-10)3-5-4-13-16-9(5)8(7)12/h3-4,10H,1-2H2 |
| InChIKey | BYSWWYMEWFCNBR-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 44.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.17 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-(1,3-dioxolan-2-yl)-6,7-difluoro-1,2-benzoxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(1,3-dioxolan-2-yl)-6,7-difluoro-1,2-benzoxazole?
The IUPAC name of 5-(1,3-dioxolan-2-yl)-6,7-difluoro-1,2-benzoxazole (CID 172693230) is 5-(1,3-dioxolan-2-yl)-6,7-difluoro-1,2-benzoxazole.
What is the SMILES notation for 5-(1,3-dioxolan-2-yl)-6,7-difluoro-1,2-benzoxazole?
The canonical SMILES for 5-(1,3-dioxolan-2-yl)-6,7-difluoro-1,2-benzoxazole is Fc1c(C2OCCO2)cc2cnoc2c1F.
What is the InChIKey of 5-(1,3-dioxolan-2-yl)-6,7-difluoro-1,2-benzoxazole?
The InChIKey is BYSWWYMEWFCNBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7F2NO3/c11-7-6(10-14-1-2-15-10)3-5-4-13-16-9(5)8(7)12/h3-4,10H,1-2H2.
What are the key properties of 5-(1,3-dioxolan-2-yl)-6,7-difluoro-1,2-benzoxazole?
5-(1,3-dioxolan-2-yl)-6,7-difluoro-1,2-benzoxazole has a molecular weight of 227.17 g/mol, XLogP of 2.15, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(1,3-dioxolan-2-yl)-6,7-difluoro-1,2-benzoxazole is sourced from PubChem (CID 172693230), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).