C14H9F2IN2O4S — CID 146499721
3-[5-(1,3-dioxolan-2-yl)-6,7-difluoro-1,2-benzoxazol-3-yl]-5-(iodomethyl)-1,3-thiazol-2-one (PubChem CID 146499721) has the molecular formula C14H9F2IN2O4S and a molecular weight of 466.20 g/mol. Its IUPAC name is 3-[5-(1,3-dioxolan-2-yl)-6,7-difluoro-1,2-benzoxazol-3-yl]-5-(iodomethyl)-1,3-thiazol-2-one.
| Compound Name | 3-[5-(1,3-dioxolan-2-yl)-6,7-difluoro-1,2-benzoxazol-3-yl]-5-(iodomethyl)-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 146499721 |
| Molecular Formula | C14H9F2IN2O4S |
| Molecular Weight | 466.20 g/mol |
| Exact Mass | 465.93 |
| IUPAC Name | 3-[5-(1,3-dioxolan-2-yl)-6,7-difluoro-1,2-benzoxazol-3-yl]-5-(iodomethyl)-1,3-thiazol-2-one |
| SMILES | O=c1sc(CI)cn1-c1noc2c(F)c(F)c(C3OCCO3)cc12 |
| InChI | InChI=1S/C14H9F2IN2O4S/c15-9-7(13-21-1-2-22-13)3-8-11(10(9)16)23-18-12(8)19-5-6(4-17)24-14(19)20/h3,5,13H,1-2,4H2 |
| InChIKey | GMWJWXBPFDMBBS-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 66.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.20 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|