C15H16F2N2O4S — CID 146539155
S-[2-[[5-(1,3-dioxolan-2-yl)-6,7-difluoro-1,2-benzoxazol-3-yl]amino]propyl] ethanethioate (PubChem CID 146539155) has the molecular formula C15H16F2N2O4S and a molecular weight of 358.37 g/mol. Its IUPAC name is S-[2-[[5-(1,3-dioxolan-2-yl)-6,7-difluoro-1,2-benzoxazol-3-yl]amino]propyl] ethanethioate.
| Compound Name | S-[2-[[5-(1,3-dioxolan-2-yl)-6,7-difluoro-1,2-benzoxazol-3-yl]amino]propyl] ethanethioate |
|---|---|
| PubChem CID | 146539155 |
| Molecular Formula | C15H16F2N2O4S |
| Molecular Weight | 358.37 g/mol |
| Exact Mass | 358.08 |
| IUPAC Name | S-[2-[[5-(1,3-dioxolan-2-yl)-6,7-difluoro-1,2-benzoxazol-3-yl]amino]propyl] ethanethioate |
| SMILES | CC(=O)SCC(C)Nc1noc2c(F)c(F)c(C3OCCO3)cc12 |
| InChI | InChI=1S/C15H16F2N2O4S/c1-7(6-24-8(2)20)18-14-10-5-9(15-21-3-4-22-15)11(16)12(17)13(10)23-19-14/h5,7,15H,3-4,6H2,1-2H3,(H,18,19) |
| InChIKey | WVMDHYGYGUEVLW-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 73.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.37 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|