C15H14F2N2O4S — CID 146539184
(4S)-3-[5-(1,3-dioxolan-2-yl)-6,7-difluoro-1,2-benzoxazol-3-yl]-4-ethyl-1,3-thiazolidin-2-one (PubChem CID 146539184) has the molecular formula C15H14F2N2O4S and a molecular weight of 356.35 g/mol. Its IUPAC name is (4S)-3-[5-(1,3-dioxolan-2-yl)-6,7-difluoro-1,2-benzoxazol-3-yl]-4-ethyl-1,3-thiazolidin-2-one.
| Compound Name | (4S)-3-[5-(1,3-dioxolan-2-yl)-6,7-difluoro-1,2-benzoxazol-3-yl]-4-ethyl-1,3-thiazolidin-2-one |
|---|---|
| PubChem CID | 146539184 |
| Molecular Formula | C15H14F2N2O4S |
| Molecular Weight | 356.35 g/mol |
| Exact Mass | 356.06 |
| IUPAC Name | (4S)-3-[5-(1,3-dioxolan-2-yl)-6,7-difluoro-1,2-benzoxazol-3-yl]-4-ethyl-1,3-thiazolidin-2-one |
| SMILES | CC[C@H]1CSC(=O)N1c1noc2c(F)c(F)c(C3OCCO3)cc12 |
| InChI | InChI=1S/C15H14F2N2O4S/c1-2-7-6-24-15(20)19(7)13-9-5-8(14-21-3-4-22-14)10(16)11(17)12(9)23-18-13/h5,7,14H,2-4,6H2,1H3/t7-/m0/s1 |
| InChIKey | ACBDTUFPAMHUEY-ZETCQYMHSA-N |
| XLogP | 3.60 |
| TPSA | 64.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.35 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|