C12H12F2N2O5 — CID 146539177
2-[[5-(1,3-dioxolan-2-yl)-6,7-difluoro-1,2-benzoxazol-3-yl]amino]ethane-1,1-diol (PubChem CID 146539177) has the molecular formula C12H12F2N2O5 and a molecular weight of 302.23 g/mol. Its IUPAC name is 2-[[5-(1,3-dioxolan-2-yl)-6,7-difluoro-1,2-benzoxazol-3-yl]amino]ethane-1,1-diol.
| Compound Name | 2-[[5-(1,3-dioxolan-2-yl)-6,7-difluoro-1,2-benzoxazol-3-yl]amino]ethane-1,1-diol |
|---|---|
| PubChem CID | 146539177 |
| Molecular Formula | C12H12F2N2O5 |
| Molecular Weight | 302.23 g/mol |
| Exact Mass | 302.07 |
| IUPAC Name | 2-[[5-(1,3-dioxolan-2-yl)-6,7-difluoro-1,2-benzoxazol-3-yl]amino]ethane-1,1-diol |
| SMILES | OC(O)CNc1noc2c(F)c(F)c(C3OCCO3)cc12 |
| InChI | InChI=1S/C12H12F2N2O5/c13-8-5(12-19-1-2-20-12)3-6-10(9(8)14)21-16-11(6)15-4-7(17)18/h3,7,12,17-18H,1-2,4H2,(H,15,16) |
| InChIKey | DVGQIBRECLBDFH-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 96.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.23 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|