C17H16F2N2O4S — CID 146499738
(3aR,7aS)-3-[5-(1,3-dioxolan-2-yl)-6,7-difluoro-1,2-benzoxazol-3-yl]-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazol-2-one (PubChem CID 146499738) has the molecular formula C17H16F2N2O4S and a molecular weight of 382.39 g/mol. Its IUPAC name is (3aR,7aS)-3-[5-(1,3-dioxolan-2-yl)-6,7-difluoro-1,2-benzoxazol-3-yl]-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazol-2-one.
| Compound Name | (3aR,7aS)-3-[5-(1,3-dioxolan-2-yl)-6,7-difluoro-1,2-benzoxazol-3-yl]-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazol-2-one |
|---|---|
| PubChem CID | 146499738 |
| Molecular Formula | C17H16F2N2O4S |
| Molecular Weight | 382.39 g/mol |
| Exact Mass | 382.08 |
| IUPAC Name | (3aR,7aS)-3-[5-(1,3-dioxolan-2-yl)-6,7-difluoro-1,2-benzoxazol-3-yl]-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazol-2-one |
| SMILES | O=C1S[C@H]2CCCC[C@H]2N1c1noc2c(F)c(F)c(C3OCCO3)cc12 |
| InChI | InChI=1S/C17H16F2N2O4S/c18-12-8(16-23-5-6-24-16)7-9-14(13(12)19)25-20-15(9)21-10-3-1-2-4-11(10)26-17(21)22/h7,10-11,16H,1-6H2/t10-,11+/m1/s1 |
| InChIKey | GZJOJBJFOQMTBU-MNOVXSKESA-N |
| XLogP | 4.14 |
| TPSA | 64.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.39 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|