C10H10F2O3 — CID 162421197
2-(2,4-difluoro-3-methoxyphenyl)-1,3-dioxolane (PubChem CID 162421197) has the molecular formula C10H10F2O3 and a molecular weight of 216.18 g/mol. Its IUPAC name is 2-(2,4-difluoro-3-methoxyphenyl)-1,3-dioxolane.
| Compound Name | 2-(2,4-difluoro-3-methoxyphenyl)-1,3-dioxolane |
|---|---|
| PubChem CID | 162421197 |
| Molecular Formula | C10H10F2O3 |
| Molecular Weight | 216.18 g/mol |
| Exact Mass | 216.06 |
| IUPAC Name | 2-(2,4-difluoro-3-methoxyphenyl)-1,3-dioxolane |
| SMILES | COc1c(F)ccc(C2OCCO2)c1F |
| InChI | InChI=1S/C10H10F2O3/c1-13-9-7(11)3-2-6(8(9)12)10-14-4-5-15-10/h2-3,10H,4-5H2,1H3 |
| InChIKey | YVYPQIUMOKXBOG-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.18 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |