C10H12FNO — CID 55294576
5-fluoro-4-methoxy-2,3-dihydro-1H-inden-1-amine (PubChem CID 55294576) has the molecular formula C10H12FNO and a molecular weight of 181.21 g/mol. Its IUPAC name is 5-fluoro-4-methoxy-2,3-dihydro-1H-inden-1-amine.
| Compound Name | 5-fluoro-4-methoxy-2,3-dihydro-1H-inden-1-amine |
|---|---|
| PubChem CID | 55294576 |
| Molecular Formula | C10H12FNO |
| Molecular Weight | 181.21 g/mol |
| Exact Mass | 181.09 |
| IUPAC Name | 5-fluoro-4-methoxy-2,3-dihydro-1H-inden-1-amine |
| SMILES | COc1c(F)ccc2c1CCC2N |
| InChI | InChI=1S/C10H12FNO/c1-13-10-7-3-5-9(12)6(7)2-4-8(10)11/h2,4,9H,3,5,12H2,1H3 |
| InChIKey | KANPBLWDNPDNKH-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.21 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |