C10H11Br2NO — CID 130706079
(1S)-4,6-dibromo-5-methoxy-2,3-dihydro-1H-inden-1-amine (PubChem CID 130706079) has the molecular formula C10H11Br2NO and a molecular weight of 321.01 g/mol. Its IUPAC name is (1S)-4,6-dibromo-5-methoxy-2,3-dihydro-1H-inden-1-amine.
| Compound Name | (1S)-4,6-dibromo-5-methoxy-2,3-dihydro-1H-inden-1-amine |
|---|---|
| PubChem CID | 130706079 |
| Molecular Formula | C10H11Br2NO |
| Molecular Weight | 321.01 g/mol |
| Exact Mass | 318.92 |
| IUPAC Name | (1S)-4,6-dibromo-5-methoxy-2,3-dihydro-1H-inden-1-amine |
| SMILES | COc1c(Br)cc2c(c1Br)CC[C@@H]2N |
| InChI | InChI=1S/C10H11Br2NO/c1-14-10-7(11)4-6-5(9(10)12)2-3-8(6)13/h4,8H,2-3,13H2,1H3/t8-/m0/s1 |
| InChIKey | OYQJZOUALPJFAH-QMMMGPOBSA-N |
| XLogP | 3.17 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.01 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |