About (1R)-4-bromo-6-methyl-2,3-dihydro-1H-inden-1-amine
(1R)-4-bromo-6-methyl-2,3-dihydro-1H-inden-1-amine (PubChem CID 130673475) has the molecular formula C10H12BrN
and a molecular weight of 226.12 g/mol. Its IUPAC name is (1R)-4-bromo-6-methyl-2,3-dihydro-1H-inden-1-amine.
Molecular Properties
| Compound Name | (1R)-4-bromo-6-methyl-2,3-dihydro-1H-inden-1-amine |
| PubChem CID | 130673475 |
| Molecular Formula | C10H12BrN |
| Molecular Weight | 226.12 g/mol |
| Exact Mass | 225.02 |
| IUPAC Name | (1R)-4-bromo-6-methyl-2,3-dihydro-1H-inden-1-amine |
| SMILES | Cc1cc(Br)c2c(c1)[C@H](N)CC2 |
| InChI | InChI=1S/C10H12BrN/c1-6-4-8-7(9(11)5-6)2-3-10(8)12/h4-5,10H,2-3,12H2,1H3/t10-/m1/s1 |
| InChIKey | ZTVOBQOGJGGIJZ-SNVBAGLBSA-N |
| XLogP | 2.70 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.12 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (1R)-4-bromo-6-methyl-2,3-dihydro-1H-inden-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R)-4-bromo-6-methyl-2,3-dihydro-1H-inden-1-amine?
The IUPAC name of (1R)-4-bromo-6-methyl-2,3-dihydro-1H-inden-1-amine (CID 130673475) is (1R)-4-bromo-6-methyl-2,3-dihydro-1H-inden-1-amine.
What is the SMILES notation for (1R)-4-bromo-6-methyl-2,3-dihydro-1H-inden-1-amine?
The canonical SMILES for (1R)-4-bromo-6-methyl-2,3-dihydro-1H-inden-1-amine is Cc1cc(Br)c2c(c1)[C@H](N)CC2.
What is the InChIKey of (1R)-4-bromo-6-methyl-2,3-dihydro-1H-inden-1-amine?
The InChIKey is ZTVOBQOGJGGIJZ-SNVBAGLBSA-N. The full InChI is InChI=1S/C10H12BrN/c1-6-4-8-7(9(11)5-6)2-3-10(8)12/h4-5,10H,2-3,12H2,1H3/t10-/m1/s1.
What are the key properties of (1R)-4-bromo-6-methyl-2,3-dihydro-1H-inden-1-amine?
(1R)-4-bromo-6-methyl-2,3-dihydro-1H-inden-1-amine has a molecular weight of 226.12 g/mol, XLogP of 2.70, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1R)-4-bromo-6-methyl-2,3-dihydro-1H-inden-1-amine is sourced from PubChem (CID 130673475), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).