C10H13NO2 — CID 130664492
(1S)-1-amino-6-methoxy-2,3-dihydro-1H-inden-4-ol (PubChem CID 130664492) has the molecular formula C10H13NO2 and a molecular weight of 179.22 g/mol. Its IUPAC name is (1S)-1-amino-6-methoxy-2,3-dihydro-1H-inden-4-ol.
| Compound Name | (1S)-1-amino-6-methoxy-2,3-dihydro-1H-inden-4-ol |
|---|---|
| PubChem CID | 130664492 |
| Molecular Formula | C10H13NO2 |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.09 |
| IUPAC Name | (1S)-1-amino-6-methoxy-2,3-dihydro-1H-inden-4-ol |
| SMILES | COc1cc(O)c2c(c1)[C@@H](N)CC2 |
| InChI | InChI=1S/C10H13NO2/c1-13-6-4-8-7(10(12)5-6)2-3-9(8)11/h4-5,9,12H,2-3,11H2,1H3/t9-/m0/s1 |
| InChIKey | ZVPTXHFPSLRDLC-VIFPVBQESA-N |
| XLogP | 1.35 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |