About (3S)-3-amino-7-iodo-2,3-dihydro-1H-inden-5-ol
(3S)-3-amino-7-iodo-2,3-dihydro-1H-inden-5-ol (PubChem CID 130648423) has the molecular formula C9H10INO
and a molecular weight of 275.09 g/mol. Its IUPAC name is (3S)-3-amino-7-iodo-2,3-dihydro-1H-inden-5-ol.
Molecular Properties
| Compound Name | (3S)-3-amino-7-iodo-2,3-dihydro-1H-inden-5-ol |
| PubChem CID | 130648423 |
| Molecular Formula | C9H10INO |
| Molecular Weight | 275.09 g/mol |
| Exact Mass | 274.98 |
| IUPAC Name | (3S)-3-amino-7-iodo-2,3-dihydro-1H-inden-5-ol |
| SMILES | N[C@H]1CCc2c(I)cc(O)cc21 |
| InChI | InChI=1S/C9H10INO/c10-8-4-5(12)3-7-6(8)1-2-9(7)11/h3-4,9,12H,1-2,11H2/t9-/m0/s1 |
| InChIKey | XBEKMQYRTRJUKG-VIFPVBQESA-N |
| XLogP | 1.94 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.09 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze (3S)-3-amino-7-iodo-2,3-dihydro-1H-inden-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-3-amino-7-iodo-2,3-dihydro-1H-inden-5-ol?
The IUPAC name of (3S)-3-amino-7-iodo-2,3-dihydro-1H-inden-5-ol (CID 130648423) is (3S)-3-amino-7-iodo-2,3-dihydro-1H-inden-5-ol.
What is the SMILES notation for (3S)-3-amino-7-iodo-2,3-dihydro-1H-inden-5-ol?
The canonical SMILES for (3S)-3-amino-7-iodo-2,3-dihydro-1H-inden-5-ol is N[C@H]1CCc2c(I)cc(O)cc21.
What is the InChIKey of (3S)-3-amino-7-iodo-2,3-dihydro-1H-inden-5-ol?
The InChIKey is XBEKMQYRTRJUKG-VIFPVBQESA-N. The full InChI is InChI=1S/C9H10INO/c10-8-4-5(12)3-7-6(8)1-2-9(7)11/h3-4,9,12H,1-2,11H2/t9-/m0/s1.
What are the key properties of (3S)-3-amino-7-iodo-2,3-dihydro-1H-inden-5-ol?
(3S)-3-amino-7-iodo-2,3-dihydro-1H-inden-5-ol has a molecular weight of 275.09 g/mol, XLogP of 1.94, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3-amino-7-iodo-2,3-dihydro-1H-inden-5-ol is sourced from PubChem (CID 130648423), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).