C10H9IN2 — CID 130739664
(3S)-3-amino-7-iodo-2,3-dihydro-1H-indene-5-carbonitrile (PubChem CID 130739664) has the molecular formula C10H9IN2 and a molecular weight of 284.10 g/mol. Its IUPAC name is (3S)-3-amino-7-iodo-2,3-dihydro-1H-indene-5-carbonitrile.
| Compound Name | (3S)-3-amino-7-iodo-2,3-dihydro-1H-indene-5-carbonitrile |
|---|---|
| PubChem CID | 130739664 |
| Molecular Formula | C10H9IN2 |
| Molecular Weight | 284.10 g/mol |
| Exact Mass | 283.98 |
| IUPAC Name | (3S)-3-amino-7-iodo-2,3-dihydro-1H-indene-5-carbonitrile |
| SMILES | N#Cc1cc(I)c2c(c1)[C@@H](N)CC2 |
| InChI | InChI=1S/C10H9IN2/c11-9-4-6(5-12)3-8-7(9)1-2-10(8)13/h3-4,10H,1-2,13H2/t10-/m0/s1 |
| InChIKey | MPDIYBTWQXRPLQ-JTQLQIEISA-N |
| XLogP | 2.11 |
| TPSA | 49.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.10 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|