C11H9N3 — CID 130631178
(1R)-1-amino-2,3-dihydro-1H-indene-4,6-dicarbonitrile (PubChem CID 130631178) has the molecular formula C11H9N3 and a molecular weight of 183.21 g/mol. Its IUPAC name is (1R)-1-amino-2,3-dihydro-1H-indene-4,6-dicarbonitrile.
| Compound Name | (1R)-1-amino-2,3-dihydro-1H-indene-4,6-dicarbonitrile |
|---|---|
| PubChem CID | 130631178 |
| Molecular Formula | C11H9N3 |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.08 |
| IUPAC Name | (1R)-1-amino-2,3-dihydro-1H-indene-4,6-dicarbonitrile |
| SMILES | N#Cc1cc(C#N)c2c(c1)[C@H](N)CC2 |
| InChI | InChI=1S/C11H9N3/c12-5-7-3-8(6-13)9-1-2-11(14)10(9)4-7/h3-4,11H,1-2,14H2/t11-/m1/s1 |
| InChIKey | ACWAADGGZFCWCY-LLVKDONJSA-N |
| XLogP | 1.38 |
| TPSA | 73.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |