C12H25FN4 — CID 175262813
4-fluoro-2,3-dihydro-1H-inden-1-amine;methanamine (PubChem CID 175262813) has the molecular formula C12H25FN4 and a molecular weight of 244.36 g/mol. Its IUPAC name is 4-fluoro-2,3-dihydro-1H-inden-1-amine;methanamine.
| Compound Name | 4-fluoro-2,3-dihydro-1H-inden-1-amine;methanamine |
|---|---|
| PubChem CID | 175262813 |
| Molecular Formula | C12H25FN4 |
| Molecular Weight | 244.36 g/mol |
| Exact Mass | 244.21 |
| IUPAC Name | 4-fluoro-2,3-dihydro-1H-inden-1-amine;methanamine |
| SMILES | CN.CN.CN.NC1CCc2c(F)cccc21 |
| InChI | InChI=1S/C9H10FN.3CH5N/c10-8-3-1-2-7-6(8)4-5-9(7)11;3*1-2/h1-3,9H,4-5,11H2;3*2H2,1H3 |
| InChIKey | VMGMNCXFLGOUEZ-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 104.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.36 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |