About 4-fluoro-2,3-dihydro-1H-indene-1-thiol
4-fluoro-2,3-dihydro-1H-indene-1-thiol (PubChem CID 83070034) has the molecular formula C9H9FS
and a molecular weight of 168.24 g/mol. Its IUPAC name is 4-fluoro-2,3-dihydro-1H-indene-1-thiol.
Molecular Properties
| Compound Name | 4-fluoro-2,3-dihydro-1H-indene-1-thiol |
| PubChem CID | 83070034 |
| Molecular Formula | C9H9FS |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.04 |
| IUPAC Name | 4-fluoro-2,3-dihydro-1H-indene-1-thiol |
| SMILES | Fc1cccc2c1CCC2S |
| InChI | InChI=1S/C9H9FS/c10-8-3-1-2-7-6(8)4-5-9(7)11/h1-3,9,11H,4-5H2 |
| InChIKey | VBWKOUPIBXWPEK-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 4-fluoro-2,3-dihydro-1H-indene-1-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluoro-2,3-dihydro-1H-indene-1-thiol?
The IUPAC name of 4-fluoro-2,3-dihydro-1H-indene-1-thiol (CID 83070034) is 4-fluoro-2,3-dihydro-1H-indene-1-thiol.
What is the SMILES notation for 4-fluoro-2,3-dihydro-1H-indene-1-thiol?
The canonical SMILES for 4-fluoro-2,3-dihydro-1H-indene-1-thiol is Fc1cccc2c1CCC2S.
What is the InChIKey of 4-fluoro-2,3-dihydro-1H-indene-1-thiol?
The InChIKey is VBWKOUPIBXWPEK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9FS/c10-8-3-1-2-7-6(8)4-5-9(7)11/h1-3,9,11H,4-5H2.
What are the key properties of 4-fluoro-2,3-dihydro-1H-indene-1-thiol?
4-fluoro-2,3-dihydro-1H-indene-1-thiol has a molecular weight of 168.24 g/mol, XLogP of 2.74, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluoro-2,3-dihydro-1H-indene-1-thiol is sourced from PubChem (CID 83070034), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).